C24H39NO5 — CID 162955659
methyl (1S,4aS,4bS,8R,8aS,9S,10aR)-9-hydroxy-1,4a,8-trimethyl-7-[2-[2-(methylamino)ethoxy]-2-oxoethylidene]-3,4,4b,5,6,8,8a,9,10,10a-decahydro-2H-phenanthrene-1-carboxylate (PubChem CID 162955659) has the molecular formula C24H39NO5 and a molecular weight of 421.58 g/mol. Its IUPAC name is methyl (1S,4aS,4bS,8R,8aS,9S,10aR)-9-hydroxy-1,4a,8-trimethyl-7-[2-[2-(methylamino)ethoxy]-2-oxoethylidene]-3,4,4b,5,6,8,8a,9,10,10a-decahydro-2H-phenanthrene-1-carboxylate.
| Compound Name | methyl (1S,4aS,4bS,8R,8aS,9S,10aR)-9-hydroxy-1,4a,8-trimethyl-7-[2-[2-(methylamino)ethoxy]-2-oxoethylidene]-3,4,4b,5,6,8,8a,9,10,10a-decahydro-2H-phenanthrene-1-carboxylate |
|---|---|
| PubChem CID | 162955659 |
| Molecular Formula | C24H39NO5 |
| Molecular Weight | 421.58 g/mol |
| Exact Mass | 421.28 |
| IUPAC Name | methyl (1S,4aS,4bS,8R,8aS,9S,10aR)-9-hydroxy-1,4a,8-trimethyl-7-[2-[2-(methylamino)ethoxy]-2-oxoethylidene]-3,4,4b,5,6,8,8a,9,10,10a-decahydro-2H-phenanthrene-1-carboxylate |
| SMILES | CNCCOC(=O)C=C1CC[C@H]2[C@@H]([C@@H](O)C[C@@H]3[C@@]2(C)CCC[C@]3(C)C(=O)OC)[C@H]1C |
| InChI | InChI=1S/C24H39NO5/c1-15-16(13-20(27)30-12-11-25-4)7-8-17-21(15)18(26)14-19-23(17,2)9-6-10-24(19,3)22(28)29-5/h13,15,17-19,21,25-26H,6-12,14H2,1-5H3/t15-,17-,18-,19+,21-,23-,24-/m0/s1 |
| InChIKey | COAPCKUZMKOWBC-WTBNLRQJSA-N |
| XLogP | 3.09 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.58 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|