C22H35NO3 — CID 168954359
2-(methylamino)ethyl (2E)-2-[(4bR)-4b,8,8-trimethyl-10-oxo-1,3,4,4a,5,6,7,8a,9,10a-decahydrophenanthren-2-ylidene]acetate (PubChem CID 168954359) has the molecular formula C22H35NO3 and a molecular weight of 361.53 g/mol. Its IUPAC name is 2-(methylamino)ethyl (2E)-2-[(4bR)-4b,8,8-trimethyl-10-oxo-1,3,4,4a,5,6,7,8a,9,10a-decahydrophenanthren-2-ylidene]acetate.
| Compound Name | 2-(methylamino)ethyl (2E)-2-[(4bR)-4b,8,8-trimethyl-10-oxo-1,3,4,4a,5,6,7,8a,9,10a-decahydrophenanthren-2-ylidene]acetate |
|---|---|
| PubChem CID | 168954359 |
| Molecular Formula | C22H35NO3 |
| Molecular Weight | 361.53 g/mol |
| Exact Mass | 361.26 |
| IUPAC Name | 2-(methylamino)ethyl (2E)-2-[(4bR)-4b,8,8-trimethyl-10-oxo-1,3,4,4a,5,6,7,8a,9,10a-decahydrophenanthren-2-ylidene]acetate |
| SMILES | CNCCOC(=O)/C=C1\CCC2C(C1)C(=O)CC1C(C)(C)CCC[C@]21C |
| InChI | InChI=1S/C22H35NO3/c1-21(2)8-5-9-22(3)17-7-6-15(13-20(25)26-11-10-23-4)12-16(17)18(24)14-19(21)22/h13,16-17,19,23H,5-12,14H2,1-4H3/b15-13+/t16?,17?,19?,22-/m1/s1 |
| InChIKey | NMPXNBBAXMUPNA-CBDKGTEVSA-N |
| XLogP | 3.90 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.53 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|