C24H35NO6 — CID 163058344
methyl (1S,4aR,4bS,8R,8aR,10aR)-1,4a,8-trimethyl-7-[2-[2-(methylamino)ethoxy]-2-oxoethylidene]-9,10-dioxo-3,4,4b,5,6,8,8a,10a-octahydro-2H-phenanthrene-1-carboxylate (PubChem CID 163058344) has the molecular formula C24H35NO6 and a molecular weight of 433.55 g/mol. Its IUPAC name is methyl (1S,4aR,4bS,8R,8aR,10aR)-1,4a,8-trimethyl-7-[2-[2-(methylamino)ethoxy]-2-oxoethylidene]-9,10-dioxo-3,4,4b,5,6,8,8a,10a-octahydro-2H-phenanthrene-1-carboxylate.
| Compound Name | methyl (1S,4aR,4bS,8R,8aR,10aR)-1,4a,8-trimethyl-7-[2-[2-(methylamino)ethoxy]-2-oxoethylidene]-9,10-dioxo-3,4,4b,5,6,8,8a,10a-octahydro-2H-phenanthrene-1-carboxylate |
|---|---|
| PubChem CID | 163058344 |
| Molecular Formula | C24H35NO6 |
| Molecular Weight | 433.55 g/mol |
| Exact Mass | 433.25 |
| IUPAC Name | methyl (1S,4aR,4bS,8R,8aR,10aR)-1,4a,8-trimethyl-7-[2-[2-(methylamino)ethoxy]-2-oxoethylidene]-9,10-dioxo-3,4,4b,5,6,8,8a,10a-octahydro-2H-phenanthrene-1-carboxylate |
| SMILES | CNCCOC(=O)C=C1CC[C@H]2[C@H](C(=O)C(=O)[C@@H]3[C@]2(C)CCC[C@]3(C)C(=O)OC)[C@H]1C |
| InChI | InChI=1S/C24H35NO6/c1-14-15(13-17(26)31-12-11-25-4)7-8-16-18(14)19(27)20(28)21-23(16,2)9-6-10-24(21,3)22(29)30-5/h13-14,16,18,21,25H,6-12H2,1-5H3/t14-,16-,18+,21+,23+,24-/m0/s1 |
| InChIKey | ZZODRCCZLRFTIB-SQHCDJMKSA-N |
| XLogP | 2.48 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.55 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|