C26H43NO5 — CID 25128605
2-(dimethylamino)ethyl (2E)-2-[(1R,4aS,4bR,7S,8aR,10aS)-7-(methoxymethoxy)-1,4b,8,8-tetramethyl-10-oxo-1,3,4,4a,5,6,7,8a,9,10a-decahydrophenanthren-2-ylidene]acetate (PubChem CID 25128605) has the molecular formula C26H43NO5 and a molecular weight of 449.63 g/mol. Its IUPAC name is 2-(dimethylamino)ethyl (2E)-2-[(1R,4aS,4bR,7S,8aR,10aS)-7-(methoxymethoxy)-1,4b,8,8-tetramethyl-10-oxo-1,3,4,4a,5,6,7,8a,9,10a-decahydrophenanthren-2-ylidene]acetate.
| Compound Name | 2-(dimethylamino)ethyl (2E)-2-[(1R,4aS,4bR,7S,8aR,10aS)-7-(methoxymethoxy)-1,4b,8,8-tetramethyl-10-oxo-1,3,4,4a,5,6,7,8a,9,10a-decahydrophenanthren-2-ylidene]acetate |
|---|---|
| PubChem CID | 25128605 |
| Molecular Formula | C26H43NO5 |
| Molecular Weight | 449.63 g/mol |
| Exact Mass | 449.31 |
| IUPAC Name | 2-(dimethylamino)ethyl (2E)-2-[(1R,4aS,4bR,7S,8aR,10aS)-7-(methoxymethoxy)-1,4b,8,8-tetramethyl-10-oxo-1,3,4,4a,5,6,7,8a,9,10a-decahydrophenanthren-2-ylidene]acetate |
| SMILES | COCO[C@H]1CC[C@]2(C)[C@H]3CC/C(=C\C(=O)OCCN(C)C)[C@H](C)[C@@H]3C(=O)C[C@H]2C1(C)C |
| InChI | InChI=1S/C26H43NO5/c1-17-18(14-23(29)31-13-12-27(5)6)8-9-19-24(17)20(28)15-21-25(2,3)22(32-16-30-7)10-11-26(19,21)4/h14,17,19,21-22,24H,8-13,15-16H2,1-7H3/b18-14+/t17-,19-,21-,22-,24-,26+/m0/s1 |
| InChIKey | QVQSBNFUMAWKFW-MJFYGRLZSA-N |
| XLogP | 4.08 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.63 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|