C24H39NO5 — CID 162974991
2-(dimethylamino)ethyl 2-[7-hydroxy-8-(hydroxymethyl)-1,4b,8-trimethyl-10-oxo-1,3,4,4a,5,6,7,8a,9,10a-decahydrophenanthren-2-ylidene]acetate (PubChem CID 162974991) has the molecular formula C24H39NO5 and a molecular weight of 421.58 g/mol. Its IUPAC name is 2-(dimethylamino)ethyl 2-[7-hydroxy-8-(hydroxymethyl)-1,4b,8-trimethyl-10-oxo-1,3,4,4a,5,6,7,8a,9,10a-decahydrophenanthren-2-ylidene]acetate.
| Compound Name | 2-(dimethylamino)ethyl 2-[7-hydroxy-8-(hydroxymethyl)-1,4b,8-trimethyl-10-oxo-1,3,4,4a,5,6,7,8a,9,10a-decahydrophenanthren-2-ylidene]acetate |
|---|---|
| PubChem CID | 162974991 |
| Molecular Formula | C24H39NO5 |
| Molecular Weight | 421.58 g/mol |
| Exact Mass | 421.28 |
| IUPAC Name | 2-(dimethylamino)ethyl 2-[7-hydroxy-8-(hydroxymethyl)-1,4b,8-trimethyl-10-oxo-1,3,4,4a,5,6,7,8a,9,10a-decahydrophenanthren-2-ylidene]acetate |
| SMILES | CC1C(=CC(=O)OCCN(C)C)CCC2C1C(=O)CC1C(C)(CO)C(O)CCC21C |
| InChI | InChI=1S/C24H39NO5/c1-15-16(12-21(29)30-11-10-25(4)5)6-7-17-22(15)18(27)13-19-23(17,2)9-8-20(28)24(19,3)14-26/h12,15,17,19-20,22,26,28H,6-11,13-14H2,1-5H3 |
| InChIKey | UKRGCJXIGJFLCC-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.58 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|