C29H49NO6 — CID 163011894
[(2S,4aR,4bS,8R,8aR,9S,10aR)-7-[2-[2-(dimethylamino)ethoxy]-2-oxoethylidene]-9-hydroxy-1,1,4a,8-tetramethyl-3,4,4b,5,6,8,8a,9,10,10a-decahydro-2H-phenanthren-2-yl] 3-hydroxy-3-methylbutanoate (PubChem CID 163011894) has the molecular formula C29H49NO6 and a molecular weight of 507.71 g/mol. Its IUPAC name is [(2S,4aR,4bS,8R,8aR,9S,10aR)-7-[2-[2-(dimethylamino)ethoxy]-2-oxoethylidene]-9-hydroxy-1,1,4a,8-tetramethyl-3,4,4b,5,6,8,8a,9,10,10a-decahydro-2H-phenanthren-2-yl] 3-hydroxy-3-methylbutanoate.
| Compound Name | [(2S,4aR,4bS,8R,8aR,9S,10aR)-7-[2-[2-(dimethylamino)ethoxy]-2-oxoethylidene]-9-hydroxy-1,1,4a,8-tetramethyl-3,4,4b,5,6,8,8a,9,10,10a-decahydro-2H-phenanthren-2-yl] 3-hydroxy-3-methylbutanoate |
|---|---|
| PubChem CID | 163011894 |
| Molecular Formula | C29H49NO6 |
| Molecular Weight | 507.71 g/mol |
| Exact Mass | 507.36 |
| IUPAC Name | [(2S,4aR,4bS,8R,8aR,9S,10aR)-7-[2-[2-(dimethylamino)ethoxy]-2-oxoethylidene]-9-hydroxy-1,1,4a,8-tetramethyl-3,4,4b,5,6,8,8a,9,10,10a-decahydro-2H-phenanthren-2-yl] 3-hydroxy-3-methylbutanoate |
| SMILES | C[C@H]1C(=CC(=O)OCCN(C)C)CC[C@H]2[C@@H]1[C@@H](O)C[C@H]1C(C)(C)[C@@H](OC(=O)CC(C)(C)O)CC[C@]21C |
| InChI | InChI=1S/C29H49NO6/c1-18-19(15-24(32)35-14-13-30(7)8)9-10-20-26(18)21(31)16-22-28(4,5)23(11-12-29(20,22)6)36-25(33)17-27(2,3)34/h15,18,20-23,26,31,34H,9-14,16-17H2,1-8H3/t18-,20-,21-,22-,23-,26+,29+/m0/s1 |
| InChIKey | BMDRRFQAFDHCDT-PASMMWPPSA-N |
| XLogP | 3.96 |
| TPSA | 96.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.71 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|