C28H45NO6 — CID 162905215
[(2S,4aR,4bS,7E,8R,8aS,10aR)-1,1,4a,8-tetramethyl-7-[2-[2-(methylamino)ethoxy]-2-oxoethylidene]-9-oxo-2,3,4,4b,5,6,8,8a,10,10a-decahydrophenanthren-2-yl] 3-hydroxy-3-methylbutanoate (PubChem CID 162905215) has the molecular formula C28H45NO6 and a molecular weight of 491.67 g/mol. Its IUPAC name is [(2S,4aR,4bS,7E,8R,8aS,10aR)-1,1,4a,8-tetramethyl-7-[2-[2-(methylamino)ethoxy]-2-oxoethylidene]-9-oxo-2,3,4,4b,5,6,8,8a,10,10a-decahydrophenanthren-2-yl] 3-hydroxy-3-methylbutanoate.
| Compound Name | [(2S,4aR,4bS,7E,8R,8aS,10aR)-1,1,4a,8-tetramethyl-7-[2-[2-(methylamino)ethoxy]-2-oxoethylidene]-9-oxo-2,3,4,4b,5,6,8,8a,10,10a-decahydrophenanthren-2-yl] 3-hydroxy-3-methylbutanoate |
|---|---|
| PubChem CID | 162905215 |
| Molecular Formula | C28H45NO6 |
| Molecular Weight | 491.67 g/mol |
| Exact Mass | 491.32 |
| IUPAC Name | [(2S,4aR,4bS,7E,8R,8aS,10aR)-1,1,4a,8-tetramethyl-7-[2-[2-(methylamino)ethoxy]-2-oxoethylidene]-9-oxo-2,3,4,4b,5,6,8,8a,10,10a-decahydrophenanthren-2-yl] 3-hydroxy-3-methylbutanoate |
| SMILES | CNCCOC(=O)/C=C1\CC[C@H]2[C@@H](C(=O)C[C@H]3C(C)(C)[C@@H](OC(=O)CC(C)(C)O)CC[C@]23C)[C@H]1C |
| InChI | InChI=1S/C28H45NO6/c1-17-18(14-23(31)34-13-12-29-7)8-9-19-25(17)20(30)15-21-27(4,5)22(10-11-28(19,21)6)35-24(32)16-26(2,3)33/h14,17,19,21-22,25,29,33H,8-13,15-16H2,1-7H3/b18-14+/t17-,19-,21-,22-,25-,28+/m0/s1 |
| InChIKey | CWEOPNAABDJTEA-LWNGXXMUSA-N |
| XLogP | 3.83 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.67 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|