C22H33F3O6S — CID 25128604
[(E)-[(1R,4aS,4bR,7S,8aR,10aR)-7-(methoxymethoxy)-1,4b,8,8-tetramethyl-10-oxo-1,3,4,4a,5,6,7,8a,9,10a-decahydrophenanthren-2-ylidene]methyl] trifluoromethanesulfonate (PubChem CID 25128604) has the molecular formula C22H33F3O6S and a molecular weight of 482.56 g/mol. Its IUPAC name is [(E)-[(1R,4aS,4bR,7S,8aR,10aR)-7-(methoxymethoxy)-1,4b,8,8-tetramethyl-10-oxo-1,3,4,4a,5,6,7,8a,9,10a-decahydrophenanthren-2-ylidene]methyl] trifluoromethanesulfonate.
| Compound Name | [(E)-[(1R,4aS,4bR,7S,8aR,10aR)-7-(methoxymethoxy)-1,4b,8,8-tetramethyl-10-oxo-1,3,4,4a,5,6,7,8a,9,10a-decahydrophenanthren-2-ylidene]methyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 25128604 |
| Molecular Formula | C22H33F3O6S |
| Molecular Weight | 482.56 g/mol |
| Exact Mass | 482.19 |
| IUPAC Name | [(E)-[(1R,4aS,4bR,7S,8aR,10aR)-7-(methoxymethoxy)-1,4b,8,8-tetramethyl-10-oxo-1,3,4,4a,5,6,7,8a,9,10a-decahydrophenanthren-2-ylidene]methyl] trifluoromethanesulfonate |
| SMILES | COCO[C@H]1CC[C@]2(C)[C@H]3CC/C(=C\OS(=O)(=O)C(F)(F)F)[C@H](C)[C@H]3C(=O)C[C@H]2C1(C)C |
| InChI | InChI=1S/C22H33F3O6S/c1-13-14(11-31-32(27,28)22(23,24)25)6-7-15-19(13)16(26)10-17-20(2,3)18(30-12-29-5)8-9-21(15,17)4/h11,13,15,17-19H,6-10,12H2,1-5H3/b14-11+/t13-,15-,17-,18-,19+,21+/m0/s1 |
| InChIKey | MRYORTBAHACXEJ-RGANBJROSA-N |
| XLogP | 4.80 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.56 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|