C25H40N2O5 — CID 162920305
methyl (1R,2S,4aR,4bS,7E,8R,8aR,10aR)-7-[2-[2-(dimethylamino)ethylamino]-2-oxoethylidene]-2-hydroxy-1,4a,8-trimethyl-9-oxo-2,3,4,4b,5,6,8,8a,10,10a-decahydrophenanthrene-1-carboxylate (PubChem CID 162920305) has the molecular formula C25H40N2O5 and a molecular weight of 448.60 g/mol. Its IUPAC name is methyl (1R,2S,4aR,4bS,7E,8R,8aR,10aR)-7-[2-[2-(dimethylamino)ethylamino]-2-oxoethylidene]-2-hydroxy-1,4a,8-trimethyl-9-oxo-2,3,4,4b,5,6,8,8a,10,10a-decahydrophenanthrene-1-carboxylate.
| Compound Name | methyl (1R,2S,4aR,4bS,7E,8R,8aR,10aR)-7-[2-[2-(dimethylamino)ethylamino]-2-oxoethylidene]-2-hydroxy-1,4a,8-trimethyl-9-oxo-2,3,4,4b,5,6,8,8a,10,10a-decahydrophenanthrene-1-carboxylate |
|---|---|
| PubChem CID | 162920305 |
| Molecular Formula | C25H40N2O5 |
| Molecular Weight | 448.60 g/mol |
| Exact Mass | 448.29 |
| IUPAC Name | methyl (1R,2S,4aR,4bS,7E,8R,8aR,10aR)-7-[2-[2-(dimethylamino)ethylamino]-2-oxoethylidene]-2-hydroxy-1,4a,8-trimethyl-9-oxo-2,3,4,4b,5,6,8,8a,10,10a-decahydrophenanthrene-1-carboxylate |
| SMILES | COC(=O)[C@]1(C)[C@@H]2CC(=O)[C@@H]3[C@@H](C)/C(=C/C(=O)NCCN(C)C)CC[C@@H]3[C@@]2(C)CC[C@@H]1O |
| InChI | InChI=1S/C25H40N2O5/c1-15-16(13-21(30)26-11-12-27(4)5)7-8-17-22(15)18(28)14-19-24(17,2)10-9-20(29)25(19,3)23(31)32-6/h13,15,17,19-20,22,29H,7-12,14H2,1-6H3,(H,26,30)/b16-13+/t15-,17-,19+,20-,22+,24+,25+/m0/s1 |
| InChIKey | TZEBUKDWHLEPOL-HSQRJOBMSA-N |
| XLogP | 2.18 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.60 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|