C20H26N2O2 — CID 102239130
(2S)-2-[(1S,2R,10R,12S,13S,14R,17R)-17-hydroxy-3-methyl-3,16-diazapentacyclo[10.3.1.110,13.02,10.04,9]heptadeca-4,6,8-trien-14-yl]butanal (PubChem CID 102239130) has the molecular formula C20H26N2O2 and a molecular weight of 326.44 g/mol. Its IUPAC name is (2S)-2-[(1S,2R,10R,12S,13S,14R,17R)-17-hydroxy-3-methyl-3,16-diazapentacyclo[10.3.1.110,13.02,10.04,9]heptadeca-4,6,8-trien-14-yl]butanal.
| Compound Name | (2S)-2-[(1S,2R,10R,12S,13S,14R,17R)-17-hydroxy-3-methyl-3,16-diazapentacyclo[10.3.1.110,13.02,10.04,9]heptadeca-4,6,8-trien-14-yl]butanal |
|---|---|
| PubChem CID | 102239130 |
| Molecular Formula | C20H26N2O2 |
| Molecular Weight | 326.44 g/mol |
| Exact Mass | 326.20 |
| IUPAC Name | (2S)-2-[(1S,2R,10R,12S,13S,14R,17R)-17-hydroxy-3-methyl-3,16-diazapentacyclo[10.3.1.110,13.02,10.04,9]heptadeca-4,6,8-trien-14-yl]butanal |
| SMILES | CC[C@H](C=O)[C@@H]1C[C@@H]2N[C@H]3C[C@]4(c5ccccc5N(C)[C@@H]24)[C@H](O)[C@@H]13 |
| InChI | InChI=1S/C20H26N2O2/c1-3-11(10-23)12-8-14-18-20(9-15(21-14)17(12)19(20)24)13-6-4-5-7-16(13)22(18)2/h4-7,10-12,14-15,17-19,21,24H,3,8-9H2,1-2H3/t11-,12+,14+,15+,17+,18+,19-,20-/m1/s1 |
| InChIKey | QGHJBDDCGRXPHC-XXHRDQNBSA-N |
| XLogP | 1.71 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.44 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|