C22H31N2O2+ — CID 124839387
(1S,9R,10S,12R,13S,14R,15R,16S,17S,18S)-13,15-diethyl-8-methyl-8-aza-15-azoniahexacyclo[14.2.1.01,9.02,7.010,15.012,17]nonadeca-2,4,6-triene-14,18-diol (PubChem CID 124839387) has the molecular formula C22H31N2O2+ and a molecular weight of 355.50 g/mol. Its IUPAC name is (1S,9R,10S,12R,13S,14R,15R,16S,17S,18S)-13,15-diethyl-8-methyl-8-aza-15-azoniahexacyclo[14.2.1.01,9.02,7.010,15.012,17]nonadeca-2,4,6-triene-14,18-diol.
| Compound Name | (1S,9R,10S,12R,13S,14R,15R,16S,17S,18S)-13,15-diethyl-8-methyl-8-aza-15-azoniahexacyclo[14.2.1.01,9.02,7.010,15.012,17]nonadeca-2,4,6-triene-14,18-diol |
|---|---|
| PubChem CID | 124839387 |
| Molecular Formula | C22H31N2O2+ |
| Molecular Weight | 355.50 g/mol |
| Exact Mass | 355.24 |
| IUPAC Name | (1S,9R,10S,12R,13S,14R,15R,16S,17S,18S)-13,15-diethyl-8-methyl-8-aza-15-azoniahexacyclo[14.2.1.01,9.02,7.010,15.012,17]nonadeca-2,4,6-triene-14,18-diol |
| SMILES | CC[C@H]1[C@@H]2C[C@H]3[C@@H]4N(C)c5ccccc5[C@@]45C[C@@H]([C@H]2[C@@H]5O)[N@@+]3(CC)[C@@H]1O |
| InChI | InChI=1S/C22H31N2O2/c1-4-12-13-10-16-19-22(14-8-6-7-9-15(14)23(19)3)11-17(18(13)20(22)25)24(16,5-2)21(12)26/h6-9,12-13,16-21,25-26H,4-5,10-11H2,1-3H3/q+1/t12-,13-,16-,17-,18-,19-,20-,21+,22-,24-/m0/s1 |
| InChIKey | IPJIEDBVLQTGNW-VFGBTGKVSA-N |
| XLogP | 2.09 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.50 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|