C26H37N2O2+ — CID 154809103
(9R,12S,13S,14R,16R,18S)-13-ethyl-8-methyl-15-(4-methylpent-3-enyl)-8-aza-15-azoniahexacyclo[14.2.1.01,9.02,7.010,15.012,17]nonadeca-2,4,6-triene-14,18-diol (PubChem CID 154809103) has the molecular formula C26H37N2O2+ and a molecular weight of 409.59 g/mol. Its IUPAC name is (9R,12S,13S,14R,16R,18S)-13-ethyl-8-methyl-15-(4-methylpent-3-enyl)-8-aza-15-azoniahexacyclo[14.2.1.01,9.02,7.010,15.012,17]nonadeca-2,4,6-triene-14,18-diol.
| Compound Name | (9R,12S,13S,14R,16R,18S)-13-ethyl-8-methyl-15-(4-methylpent-3-enyl)-8-aza-15-azoniahexacyclo[14.2.1.01,9.02,7.010,15.012,17]nonadeca-2,4,6-triene-14,18-diol |
|---|---|
| PubChem CID | 154809103 |
| Molecular Formula | C26H37N2O2+ |
| Molecular Weight | 409.59 g/mol |
| Exact Mass | 409.28 |
| IUPAC Name | (9R,12S,13S,14R,16R,18S)-13-ethyl-8-methyl-15-(4-methylpent-3-enyl)-8-aza-15-azoniahexacyclo[14.2.1.01,9.02,7.010,15.012,17]nonadeca-2,4,6-triene-14,18-diol |
| SMILES | CC[C@@H]1[C@@H](O)[N+]2(CCC=C(C)C)C3C[C@H]1C1C(O)C4(C[C@H]12)c1ccccc1N(C)[C@@H]34 |
| InChI | InChI=1S/C26H37N2O2/c1-5-16-17-13-20-23-26(18-10-6-7-11-19(18)27(23)4)14-21(22(17)24(26)29)28(20,25(16)30)12-8-9-15(2)3/h6-7,9-11,16-17,20-25,29-30H,5,8,12-14H2,1-4H3/q+1/t16-,17+,20?,21+,22?,23-,24?,25+,26?,28?/m0/s1 |
| InChIKey | UKHLKPBTNRMFRJ-LEAPHLNISA-N |
| XLogP | 3.43 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.59 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|