C30H47N2O2+ — CID 18397973
(1R,9R,12S,13S,14R,16S)-15-decyl-13-ethyl-8-methyl-8-aza-15-azoniahexacyclo[14.2.1.01,9.02,7.010,15.012,17]nonadeca-2,4,6-triene-14,18-diol (PubChem CID 18397973) has the molecular formula C30H47N2O2+ and a molecular weight of 467.72 g/mol. Its IUPAC name is (1R,9R,12S,13S,14R,16S)-15-decyl-13-ethyl-8-methyl-8-aza-15-azoniahexacyclo[14.2.1.01,9.02,7.010,15.012,17]nonadeca-2,4,6-triene-14,18-diol.
| Compound Name | (1R,9R,12S,13S,14R,16S)-15-decyl-13-ethyl-8-methyl-8-aza-15-azoniahexacyclo[14.2.1.01,9.02,7.010,15.012,17]nonadeca-2,4,6-triene-14,18-diol |
|---|---|
| PubChem CID | 18397973 |
| Molecular Formula | C30H47N2O2+ |
| Molecular Weight | 467.72 g/mol |
| Exact Mass | 467.36 |
| IUPAC Name | (1R,9R,12S,13S,14R,16S)-15-decyl-13-ethyl-8-methyl-8-aza-15-azoniahexacyclo[14.2.1.01,9.02,7.010,15.012,17]nonadeca-2,4,6-triene-14,18-diol |
| SMILES | CCCCCCCCCC[N+]12C3C[C@@H](C4C(O)[C@]5(C[C@@H]41)c1ccccc1N(C)[C@@H]35)[C@H](CC)[C@H]2O |
| InChI | InChI=1S/C30H47N2O2/c1-4-6-7-8-9-10-11-14-17-32-24-18-21(20(5-2)29(32)34)26-25(32)19-30(28(26)33)22-15-12-13-16-23(22)31(3)27(24)30/h12-13,15-16,20-21,24-29,33-34H,4-11,14,17-19H2,1-3H3/q+1/t20-,21+,24?,25-,26?,27-,28?,29+,30+,32?/m0/s1 |
| InChIKey | KIXWKGKZSPFKJN-GROUSRBMSA-N |
| XLogP | 5.21 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.72 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|