C26H39N2O2+ — CID 124839332
(1R,9R,10S,12S,13S,14R,15S,16S,17S,18S)-13-ethyl-15-hexyl-8-methyl-8-aza-15-azoniahexacyclo[14.2.1.01,9.02,7.010,15.012,17]nonadeca-2,4,6-triene-14,18-diol (PubChem CID 124839332) has the molecular formula C26H39N2O2+ and a molecular weight of 411.61 g/mol. Its IUPAC name is (1R,9R,10S,12S,13S,14R,15S,16S,17S,18S)-13-ethyl-15-hexyl-8-methyl-8-aza-15-azoniahexacyclo[14.2.1.01,9.02,7.010,15.012,17]nonadeca-2,4,6-triene-14,18-diol.
| Compound Name | (1R,9R,10S,12S,13S,14R,15S,16S,17S,18S)-13-ethyl-15-hexyl-8-methyl-8-aza-15-azoniahexacyclo[14.2.1.01,9.02,7.010,15.012,17]nonadeca-2,4,6-triene-14,18-diol |
|---|---|
| PubChem CID | 124839332 |
| Molecular Formula | C26H39N2O2+ |
| Molecular Weight | 411.61 g/mol |
| Exact Mass | 411.30 |
| IUPAC Name | (1R,9R,10S,12S,13S,14R,15S,16S,17S,18S)-13-ethyl-15-hexyl-8-methyl-8-aza-15-azoniahexacyclo[14.2.1.01,9.02,7.010,15.012,17]nonadeca-2,4,6-triene-14,18-diol |
| SMILES | CCCCCC[N@@+]12[C@H](O)[C@@H](CC)[C@H]3C[C@H]1[C@@H]1N(C)c4ccccc4[C@]14C[C@H]2[C@H]3[C@@H]4O |
| InChI | InChI=1S/C26H39N2O2/c1-4-6-7-10-13-28-20-14-17(16(5-2)25(28)30)22-21(28)15-26(24(22)29)18-11-8-9-12-19(18)27(3)23(20)26/h8-9,11-12,16-17,20-25,29-30H,4-7,10,13-15H2,1-3H3/q+1/t16-,17+,20-,21-,22-,23-,24-,25+,26+,28+/m0/s1 |
| InChIKey | DAECYOJSYCGTFP-RKZLFUMPSA-N |
| XLogP | 3.65 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.61 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|