C24H33N2O4+ — CID 124839353
ethyl 2-[(1S,9R,10S,12R,13S,14R,15R,16S,17R,18S)-13-ethyl-14,18-dihydroxy-8-methyl-8-aza-15-azoniahexacyclo[14.2.1.01,9.02,7.010,15.012,17]nonadeca-2,4,6-trien-15-yl]acetate (PubChem CID 124839353) has the molecular formula C24H33N2O4+ and a molecular weight of 413.54 g/mol. Its IUPAC name is ethyl 2-[(1S,9R,10S,12R,13S,14R,15R,16S,17R,18S)-13-ethyl-14,18-dihydroxy-8-methyl-8-aza-15-azoniahexacyclo[14.2.1.01,9.02,7.010,15.012,17]nonadeca-2,4,6-trien-15-yl]acetate.
| Compound Name | ethyl 2-[(1S,9R,10S,12R,13S,14R,15R,16S,17R,18S)-13-ethyl-14,18-dihydroxy-8-methyl-8-aza-15-azoniahexacyclo[14.2.1.01,9.02,7.010,15.012,17]nonadeca-2,4,6-trien-15-yl]acetate |
|---|---|
| PubChem CID | 124839353 |
| Molecular Formula | C24H33N2O4+ |
| Molecular Weight | 413.54 g/mol |
| Exact Mass | 413.24 |
| IUPAC Name | ethyl 2-[(1S,9R,10S,12R,13S,14R,15R,16S,17R,18S)-13-ethyl-14,18-dihydroxy-8-methyl-8-aza-15-azoniahexacyclo[14.2.1.01,9.02,7.010,15.012,17]nonadeca-2,4,6-trien-15-yl]acetate |
| SMILES | CCOC(=O)C[N@+]12[C@H](O)[C@@H](CC)[C@@H]3C[C@H]1[C@@H]1N(C)c4ccccc4[C@@]14C[C@H]2[C@@H]3[C@@H]4O |
| InChI | InChI=1S/C24H33N2O4/c1-4-13-14-10-17-21-24(15-8-6-7-9-16(15)25(21)3)11-18(20(14)22(24)28)26(17,23(13)29)12-19(27)30-5-2/h6-9,13-14,17-18,20-23,28-29H,4-5,10-12H2,1-3H3/q+1/t13-,14-,17-,18-,20+,21-,22-,23+,24-,26-/m0/s1 |
| InChIKey | HCECXNKBMVAQIW-GHQRZLFVSA-N |
| XLogP | 1.63 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.54 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|