C11H15NO8 — CID 102239484
[(2R,3S,6R)-3-acetyloxy-6-methoxy-4-nitro-3,6-dihydro-2H-pyran-2-yl]methyl acetate (PubChem CID 102239484) has the molecular formula C11H15NO8 and a molecular weight of 289.24 g/mol. Its IUPAC name is [(2R,3S,6R)-3-acetyloxy-6-methoxy-4-nitro-3,6-dihydro-2H-pyran-2-yl]methyl acetate.
| Compound Name | [(2R,3S,6R)-3-acetyloxy-6-methoxy-4-nitro-3,6-dihydro-2H-pyran-2-yl]methyl acetate |
|---|---|
| PubChem CID | 102239484 |
| Molecular Formula | C11H15NO8 |
| Molecular Weight | 289.24 g/mol |
| Exact Mass | 289.08 |
| IUPAC Name | [(2R,3S,6R)-3-acetyloxy-6-methoxy-4-nitro-3,6-dihydro-2H-pyran-2-yl]methyl acetate |
| SMILES | CO[C@H]1C=C([N+](=O)[O-])[C@H](OC(C)=O)[C@@H](COC(C)=O)O1 |
| InChI | InChI=1S/C11H15NO8/c1-6(13)18-5-9-11(19-7(2)14)8(12(15)16)4-10(17-3)20-9/h4,9-11H,5H2,1-3H3/t9-,10-,11+/m1/s1 |
| InChIKey | ZIOONIBXXRXEGX-MXWKQRLJSA-N |
| XLogP | 0.01 |
| TPSA | 114.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.24 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|