C14H19NO10 — CID 102239491
dimethyl 2-[(2R,3R,6R)-6-(acetyloxymethyl)-2-methoxy-4-nitro-3,6-dihydro-2H-pyran-3-yl]propanedioate (PubChem CID 102239491) has the molecular formula C14H19NO10 and a molecular weight of 361.30 g/mol. Its IUPAC name is dimethyl 2-[(2R,3R,6R)-6-(acetyloxymethyl)-2-methoxy-4-nitro-3,6-dihydro-2H-pyran-3-yl]propanedioate.
| Compound Name | dimethyl 2-[(2R,3R,6R)-6-(acetyloxymethyl)-2-methoxy-4-nitro-3,6-dihydro-2H-pyran-3-yl]propanedioate |
|---|---|
| PubChem CID | 102239491 |
| Molecular Formula | C14H19NO10 |
| Molecular Weight | 361.30 g/mol |
| Exact Mass | 361.10 |
| IUPAC Name | dimethyl 2-[(2R,3R,6R)-6-(acetyloxymethyl)-2-methoxy-4-nitro-3,6-dihydro-2H-pyran-3-yl]propanedioate |
| SMILES | COC(=O)C(C(=O)OC)[C@@H]1C([N+](=O)[O-])=C[C@H](COC(C)=O)O[C@H]1OC |
| InChI | InChI=1S/C14H19NO10/c1-7(16)24-6-8-5-9(15(19)20)10(14(23-4)25-8)11(12(17)21-2)13(18)22-3/h5,8,10-11,14H,6H2,1-4H3/t8-,10+,14-/m1/s1 |
| InChIKey | AXJFUHOEAYOION-IPURGOFSSA-N |
| XLogP | -0.34 |
| TPSA | 140.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.30 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|