C27H36N2O9 — CID 102242583
[(4aR,6R,7R,8R,8aS)-6-[(2R)-2-acetyloxy-3-cyanopropoxy]-7-(hexanoylamino)-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl] acetate (PubChem CID 102242583) has the molecular formula C27H36N2O9 and a molecular weight of 532.59 g/mol. Its IUPAC name is [(4aR,6R,7R,8R,8aS)-6-[(2R)-2-acetyloxy-3-cyanopropoxy]-7-(hexanoylamino)-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl] acetate.
| Compound Name | [(4aR,6R,7R,8R,8aS)-6-[(2R)-2-acetyloxy-3-cyanopropoxy]-7-(hexanoylamino)-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl] acetate |
|---|---|
| PubChem CID | 102242583 |
| Molecular Formula | C27H36N2O9 |
| Molecular Weight | 532.59 g/mol |
| Exact Mass | 532.24 |
| IUPAC Name | [(4aR,6R,7R,8R,8aS)-6-[(2R)-2-acetyloxy-3-cyanopropoxy]-7-(hexanoylamino)-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl] acetate |
| SMILES | CCCCCC(=O)N[C@H]1[C@H](OC[C@@H](CC#N)OC(C)=O)O[C@@H]2COC(c3ccccc3)O[C@H]2[C@@H]1OC(C)=O |
| InChI | InChI=1S/C27H36N2O9/c1-4-5-7-12-22(32)29-23-25(36-18(3)31)24-21(16-34-26(38-24)19-10-8-6-9-11-19)37-27(23)33-15-20(13-14-28)35-17(2)30/h6,8-11,20-21,23-27H,4-5,7,12-13,15-16H2,1-3H3,(H,29,32)/t20-,21-,23-,24-,25-,26?,27-/m1/s1 |
| InChIKey | CRHMZOGHXPUEIX-MTJQAXICSA-N |
| XLogP | 2.68 |
| TPSA | 142.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.59 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|