C13H24BrFSi — CID 102245944
[(3Z)-3-bromo-4-fluorobuta-1,3-dien-2-yl]-tri(propan-2-yl)silane (PubChem CID 102245944) has the molecular formula C13H24BrFSi and a molecular weight of 307.32 g/mol. Its IUPAC name is [(3Z)-3-bromo-4-fluorobuta-1,3-dien-2-yl]-tri(propan-2-yl)silane.
| Compound Name | [(3Z)-3-bromo-4-fluorobuta-1,3-dien-2-yl]-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 102245944 |
| Molecular Formula | C13H24BrFSi |
| Molecular Weight | 307.32 g/mol |
| Exact Mass | 306.08 |
| IUPAC Name | [(3Z)-3-bromo-4-fluorobuta-1,3-dien-2-yl]-tri(propan-2-yl)silane |
| SMILES | C=C(/C(Br)=C/F)[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C13H24BrFSi/c1-9(2)16(10(3)4,11(5)6)12(7)13(14)8-15/h8-11H,7H2,1-6H3/b13-8- |
| InChIKey | ZTDFUKPLLCALIW-JYRVWZFOSA-N |
| XLogP | 5.97 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.32 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|