C13H25BrSi — CID 164665145
[(1Z)-2-bromobuta-1,3-dienyl]-tri(propan-2-yl)silane (PubChem CID 164665145) has the molecular formula C13H25BrSi and a molecular weight of 289.33 g/mol. Its IUPAC name is [(1Z)-2-bromobuta-1,3-dienyl]-tri(propan-2-yl)silane.
| Compound Name | [(1Z)-2-bromobuta-1,3-dienyl]-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 164665145 |
| Molecular Formula | C13H25BrSi |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 288.09 |
| IUPAC Name | [(1Z)-2-bromobuta-1,3-dienyl]-tri(propan-2-yl)silane |
| SMILES | C=C/C(Br)=C/[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C13H25BrSi/c1-8-13(14)9-15(10(2)3,11(4)5)12(6)7/h8-12H,1H2,2-7H3/b13-9- |
| InChIKey | QCJNCUCZRRKBSD-LCYFTJDESA-N |
| XLogP | 5.67 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|