C7H13BrN2 — CID 129156946
1-[(1E)-2-bromobuta-1,3-dienyl]-1,2,2-trimethylhydrazine (PubChem CID 129156946) has the molecular formula C7H13BrN2 and a molecular weight of 205.10 g/mol. Its IUPAC name is 1-[(1E)-2-bromobuta-1,3-dienyl]-1,2,2-trimethylhydrazine.
| Compound Name | 1-[(1E)-2-bromobuta-1,3-dienyl]-1,2,2-trimethylhydrazine |
|---|---|
| PubChem CID | 129156946 |
| Molecular Formula | C7H13BrN2 |
| Molecular Weight | 205.10 g/mol |
| Exact Mass | 204.03 |
| IUPAC Name | 1-[(1E)-2-bromobuta-1,3-dienyl]-1,2,2-trimethylhydrazine |
| SMILES | C=C/C(Br)=C\N(C)N(C)C |
| InChI | InChI=1S/C7H13BrN2/c1-5-7(8)6-10(4)9(2)3/h5-6H,1H2,2-4H3/b7-6+ |
| InChIKey | GAIZFYMIPKIITN-VOTSOKGWSA-N |
| XLogP | 1.82 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.10 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|