About 1-[(1E)-2-bromobuta-1,3-dienyl]-1,2,2-trimethylhydrazine
1-[(1E)-2-bromobuta-1,3-dienyl]-1,2,2-trimethylhydrazine (PubChem CID 129156946) has the molecular formula C7H13BrN2
and a molecular weight of 205.10 g/mol. Its IUPAC name is 1-[(1E)-2-bromobuta-1,3-dienyl]-1,2,2-trimethylhydrazine.
Molecular Properties
| Compound Name | 1-[(1E)-2-bromobuta-1,3-dienyl]-1,2,2-trimethylhydrazine |
| PubChem CID | 129156946 |
| Molecular Formula | C7H13BrN2 |
| Molecular Weight | 205.10 g/mol |
| Exact Mass | 204.03 |
| IUPAC Name | 1-[(1E)-2-bromobuta-1,3-dienyl]-1,2,2-trimethylhydrazine |
| SMILES | C=C/C(Br)=C\N(C)N(C)C |
| InChI | InChI=1S/C7H13BrN2/c1-5-7(8)6-10(4)9(2)3/h5-6H,1H2,2-4H3/b7-6+ |
| InChIKey | GAIZFYMIPKIITN-VOTSOKGWSA-N |
| XLogP | 1.82 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.10 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 1-[(1E)-2-bromobuta-1,3-dienyl]-1,2,2-trimethylhydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(1E)-2-bromobuta-1,3-dienyl]-1,2,2-trimethylhydrazine?
The IUPAC name of 1-[(1E)-2-bromobuta-1,3-dienyl]-1,2,2-trimethylhydrazine (CID 129156946) is 1-[(1E)-2-bromobuta-1,3-dienyl]-1,2,2-trimethylhydrazine.
What is the SMILES notation for 1-[(1E)-2-bromobuta-1,3-dienyl]-1,2,2-trimethylhydrazine?
The canonical SMILES for 1-[(1E)-2-bromobuta-1,3-dienyl]-1,2,2-trimethylhydrazine is C=C/C(Br)=C\N(C)N(C)C.
What is the InChIKey of 1-[(1E)-2-bromobuta-1,3-dienyl]-1,2,2-trimethylhydrazine?
The InChIKey is GAIZFYMIPKIITN-VOTSOKGWSA-N. The full InChI is InChI=1S/C7H13BrN2/c1-5-7(8)6-10(4)9(2)3/h5-6H,1H2,2-4H3/b7-6+.
What are the key properties of 1-[(1E)-2-bromobuta-1,3-dienyl]-1,2,2-trimethylhydrazine?
1-[(1E)-2-bromobuta-1,3-dienyl]-1,2,2-trimethylhydrazine has a molecular weight of 205.10 g/mol, XLogP of 1.82, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(1E)-2-bromobuta-1,3-dienyl]-1,2,2-trimethylhydrazine is sourced from PubChem (CID 129156946), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).