C8H11BrClN — CID 176922530
N-[(1E)-2-bromobuta-1,3-dienyl]butanimidoyl chloride (PubChem CID 176922530) has the molecular formula C8H11BrClN and a molecular weight of 236.54 g/mol. Its IUPAC name is N-[(1E)-2-bromobuta-1,3-dienyl]butanimidoyl chloride.
| Compound Name | N-[(1E)-2-bromobuta-1,3-dienyl]butanimidoyl chloride |
|---|---|
| PubChem CID | 176922530 |
| Molecular Formula | C8H11BrClN |
| Molecular Weight | 236.54 g/mol |
| Exact Mass | 234.98 |
| IUPAC Name | N-[(1E)-2-bromobuta-1,3-dienyl]butanimidoyl chloride |
| SMILES | C=C/C(Br)=C\N=C(/Cl)CCC |
| InChI | InChI=1S/C8H11BrClN/c1-3-5-8(10)11-6-7(9)4-2/h4,6H,2-3,5H2,1H3/b7-6+,11-8- |
| InChIKey | JEVLQVHBIGFOLH-VEQVDCDKSA-N |
| XLogP | 3.85 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.54 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|