C8H17BrN4O — CID 139418271
N-[(1E)-2-bromobuta-1,3-dienyl]-1-hydrazinyl-N'-methoxy-N,N'-dimethylmethanediamine (PubChem CID 139418271) has the molecular formula C8H17BrN4O and a molecular weight of 265.16 g/mol. Its IUPAC name is N-[(1E)-2-bromobuta-1,3-dienyl]-1-hydrazinyl-N'-methoxy-N,N'-dimethylmethanediamine.
| Compound Name | N-[(1E)-2-bromobuta-1,3-dienyl]-1-hydrazinyl-N'-methoxy-N,N'-dimethylmethanediamine |
|---|---|
| PubChem CID | 139418271 |
| Molecular Formula | C8H17BrN4O |
| Molecular Weight | 265.16 g/mol |
| Exact Mass | 264.06 |
| IUPAC Name | N-[(1E)-2-bromobuta-1,3-dienyl]-1-hydrazinyl-N'-methoxy-N,N'-dimethylmethanediamine |
| SMILES | C=C/C(Br)=C\N(C)C(NN)N(C)OC |
| InChI | InChI=1S/C8H17BrN4O/c1-5-7(9)6-12(2)8(11-10)13(3)14-4/h5-6,8,11H,1,10H2,2-4H3/b7-6+ |
| InChIKey | QIXROAFYBATNKD-VOTSOKGWSA-N |
| XLogP | 0.58 |
| TPSA | 53.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.16 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|