About N-[(1E)-2-bromobuta-1,3-dienyl]-1-hydrazinyl-N'-methoxy-N,N'-dimethylmethanediamine
N-[(1E)-2-bromobuta-1,3-dienyl]-1-hydrazinyl-N'-methoxy-N,N'-dimethylmethanediamine (PubChem CID 139418271) has the molecular formula C8H17BrN4O
and a molecular weight of 265.16 g/mol. Its IUPAC name is N-[(1E)-2-bromobuta-1,3-dienyl]-1-hydrazinyl-N'-methoxy-N,N'-dimethylmethanediamine.
Molecular Properties
| Compound Name | N-[(1E)-2-bromobuta-1,3-dienyl]-1-hydrazinyl-N'-methoxy-N,N'-dimethylmethanediamine |
| PubChem CID | 139418271 |
| Molecular Formula | C8H17BrN4O |
| Molecular Weight | 265.16 g/mol |
| Exact Mass | 264.06 |
| IUPAC Name | N-[(1E)-2-bromobuta-1,3-dienyl]-1-hydrazinyl-N'-methoxy-N,N'-dimethylmethanediamine |
| SMILES | C=C/C(Br)=C\N(C)C(NN)N(C)OC |
| InChI | InChI=1S/C8H17BrN4O/c1-5-7(9)6-12(2)8(11-10)13(3)14-4/h5-6,8,11H,1,10H2,2-4H3/b7-6+ |
| InChIKey | QIXROAFYBATNKD-VOTSOKGWSA-N |
| XLogP | 0.58 |
| TPSA | 53.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.16 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze N-[(1E)-2-bromobuta-1,3-dienyl]-1-hydrazinyl-N'-methoxy-N,N'-dimethylmethanediamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(1E)-2-bromobuta-1,3-dienyl]-1-hydrazinyl-N'-methoxy-N,N'-dimethylmethanediamine?
The IUPAC name of N-[(1E)-2-bromobuta-1,3-dienyl]-1-hydrazinyl-N'-methoxy-N,N'-dimethylmethanediamine (CID 139418271) is N-[(1E)-2-bromobuta-1,3-dienyl]-1-hydrazinyl-N'-methoxy-N,N'-dimethylmethanediamine.
What is the SMILES notation for N-[(1E)-2-bromobuta-1,3-dienyl]-1-hydrazinyl-N'-methoxy-N,N'-dimethylmethanediamine?
The canonical SMILES for N-[(1E)-2-bromobuta-1,3-dienyl]-1-hydrazinyl-N'-methoxy-N,N'-dimethylmethanediamine is C=C/C(Br)=C\N(C)C(NN)N(C)OC.
What is the InChIKey of N-[(1E)-2-bromobuta-1,3-dienyl]-1-hydrazinyl-N'-methoxy-N,N'-dimethylmethanediamine?
The InChIKey is QIXROAFYBATNKD-VOTSOKGWSA-N. The full InChI is InChI=1S/C8H17BrN4O/c1-5-7(9)6-12(2)8(11-10)13(3)14-4/h5-6,8,11H,1,10H2,2-4H3/b7-6+.
What are the key properties of N-[(1E)-2-bromobuta-1,3-dienyl]-1-hydrazinyl-N'-methoxy-N,N'-dimethylmethanediamine?
N-[(1E)-2-bromobuta-1,3-dienyl]-1-hydrazinyl-N'-methoxy-N,N'-dimethylmethanediamine has a molecular weight of 265.16 g/mol, XLogP of 0.58, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(1E)-2-bromobuta-1,3-dienyl]-1-hydrazinyl-N'-methoxy-N,N'-dimethylmethanediamine is sourced from PubChem (CID 139418271), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).