C24H29ClO5 — CID 10224783
(2R)-7-[3-(2-chloro-4-propan-2-ylphenoxy)propoxy]-2-ethyl-3,4-dihydrochromene-2-carboxylic acid (PubChem CID 10224783) has the molecular formula C24H29ClO5 and a molecular weight of 432.94 g/mol. Its IUPAC name is (2R)-7-[3-(2-chloro-4-propan-2-ylphenoxy)propoxy]-2-ethyl-3,4-dihydrochromene-2-carboxylic acid.
| Compound Name | (2R)-7-[3-(2-chloro-4-propan-2-ylphenoxy)propoxy]-2-ethyl-3,4-dihydrochromene-2-carboxylic acid |
|---|---|
| PubChem CID | 10224783 |
| Molecular Formula | C24H29ClO5 |
| Molecular Weight | 432.94 g/mol |
| Exact Mass | 432.17 |
| IUPAC Name | (2R)-7-[3-(2-chloro-4-propan-2-ylphenoxy)propoxy]-2-ethyl-3,4-dihydrochromene-2-carboxylic acid |
| SMILES | CC[C@]1(C(=O)O)CCc2ccc(OCCCOc3ccc(C(C)C)cc3Cl)cc2O1 |
| InChI | InChI=1S/C24H29ClO5/c1-4-24(23(26)27)11-10-17-6-8-19(15-22(17)30-24)28-12-5-13-29-21-9-7-18(16(2)3)14-20(21)25/h6-9,14-16H,4-5,10-13H2,1-3H3,(H,26,27)/t24-/m1/s1 |
| InChIKey | KXLMPYRISGTYPQ-XMMPIXPASA-N |
| XLogP | 5.87 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.94 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|