C21H23NO3 — CID 102248922
(Z)-4-(2,2-diphenylpentan-3-ylamino)-4-oxobut-2-enoic acid (PubChem CID 102248922) has the molecular formula C21H23NO3 and a molecular weight of 337.42 g/mol. Its IUPAC name is (Z)-4-(2,2-diphenylpentan-3-ylamino)-4-oxobut-2-enoic acid.
| Compound Name | (Z)-4-(2,2-diphenylpentan-3-ylamino)-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 102248922 |
| Molecular Formula | C21H23NO3 |
| Molecular Weight | 337.42 g/mol |
| Exact Mass | 337.17 |
| IUPAC Name | (Z)-4-(2,2-diphenylpentan-3-ylamino)-4-oxobut-2-enoic acid |
| SMILES | CCC(NC(=O)/C=C\C(=O)O)C(C)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H23NO3/c1-3-18(22-19(23)14-15-20(24)25)21(2,16-10-6-4-7-11-16)17-12-8-5-9-13-17/h4-15,18H,3H2,1-2H3,(H,22,23)(H,24,25)/b15-14- |
| InChIKey | KNJZIOVUFDSHFX-PFONDFGASA-N |
| XLogP | 3.53 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.42 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|