C22H25N — CID 102252883
2-(2-methylpropyl)-3-phenyl-1-prop-2-enyl-1H-isoquinoline (PubChem CID 102252883) has the molecular formula C22H25N and a molecular weight of 303.45 g/mol. Its IUPAC name is 2-(2-methylpropyl)-3-phenyl-1-prop-2-enyl-1H-isoquinoline.
| Compound Name | 2-(2-methylpropyl)-3-phenyl-1-prop-2-enyl-1H-isoquinoline |
|---|---|
| PubChem CID | 102252883 |
| Molecular Formula | C22H25N |
| Molecular Weight | 303.45 g/mol |
| Exact Mass | 303.20 |
| IUPAC Name | 2-(2-methylpropyl)-3-phenyl-1-prop-2-enyl-1H-isoquinoline |
| SMILES | C=CCC1c2ccccc2C=C(c2ccccc2)N1CC(C)C |
| InChI | InChI=1S/C22H25N/c1-4-10-21-20-14-9-8-13-19(20)15-22(23(21)16-17(2)3)18-11-6-5-7-12-18/h4-9,11-15,17,21H,1,10,16H2,2-3H3 |
| InChIKey | UAQHABVMMKEKCJ-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.45 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|