C26H21ClN2O3 — CID 10225498
2-[(Z)-2-(4-chlorophenyl)ethenyl]-5,6-bis(4-methoxyphenyl)pyridazin-3-one (PubChem CID 10225498) has the molecular formula C26H21ClN2O3 and a molecular weight of 444.92 g/mol. Its IUPAC name is 2-[(Z)-2-(4-chlorophenyl)ethenyl]-5,6-bis(4-methoxyphenyl)pyridazin-3-one.
| Compound Name | 2-[(Z)-2-(4-chlorophenyl)ethenyl]-5,6-bis(4-methoxyphenyl)pyridazin-3-one |
|---|---|
| PubChem CID | 10225498 |
| Molecular Formula | C26H21ClN2O3 |
| Molecular Weight | 444.92 g/mol |
| Exact Mass | 444.12 |
| IUPAC Name | 2-[(Z)-2-(4-chlorophenyl)ethenyl]-5,6-bis(4-methoxyphenyl)pyridazin-3-one |
| SMILES | COc1ccc(-c2cc(=O)n(/C=C\c3ccc(Cl)cc3)nc2-c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C26H21ClN2O3/c1-31-22-11-5-19(6-12-22)24-17-25(30)29(16-15-18-3-9-21(27)10-4-18)28-26(24)20-7-13-23(32-2)14-8-20/h3-17H,1-2H3/b16-15- |
| InChIKey | KXUDURYBQKWMHC-NXVVXOECSA-N |
| XLogP | 5.88 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.92 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |