C10H12O2 — CID 102255092
(4aS,7aR)-1,3,4a,5,7,7a-hexahydrofuro[3,4-f][2]benzofuran (PubChem CID 102255092) has the molecular formula C10H12O2 and a molecular weight of 164.20 g/mol. Its IUPAC name is (4aS,7aR)-1,3,4a,5,7,7a-hexahydrofuro[3,4-f][2]benzofuran.
| Compound Name | (4aS,7aR)-1,3,4a,5,7,7a-hexahydrofuro[3,4-f][2]benzofuran |
|---|---|
| PubChem CID | 102255092 |
| Molecular Formula | C10H12O2 |
| Molecular Weight | 164.20 g/mol |
| Exact Mass | 164.08 |
| IUPAC Name | (4aS,7aR)-1,3,4a,5,7,7a-hexahydrofuro[3,4-f][2]benzofuran |
| SMILES | C1=C2COCC2=C[C@H]2COC[C@@H]12 |
| InChI | InChI=1S/C10H12O2/c1-7-3-11-5-9(7)2-10-6-12-4-8(1)10/h1-2,7,9H,3-6H2/t7-,9+ |
| InChIKey | GYRCBAJBYBFEAW-OTSSQURYSA-N |
| XLogP | 1.15 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.20 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |