C19H21N3O4S — CID 102255542
5-[(3aS,5R,6S,6aS)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-3-methylsulfanyl-1H-pyrazole-4-carbonitrile (PubChem CID 102255542) has the molecular formula C19H21N3O4S and a molecular weight of 387.46 g/mol. Its IUPAC name is 5-[(3aS,5R,6S,6aS)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-3-methylsulfanyl-1H-pyrazole-4-carbonitrile.
| Compound Name | 5-[(3aS,5R,6S,6aS)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-3-methylsulfanyl-1H-pyrazole-4-carbonitrile |
|---|---|
| PubChem CID | 102255542 |
| Molecular Formula | C19H21N3O4S |
| Molecular Weight | 387.46 g/mol |
| Exact Mass | 387.13 |
| IUPAC Name | 5-[(3aS,5R,6S,6aS)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-3-methylsulfanyl-1H-pyrazole-4-carbonitrile |
| SMILES | CSc1n[nH]c([C@H]2O[C@H]3OC(C)(C)O[C@H]3[C@H]2OCc2ccccc2)c1C#N |
| InChI | InChI=1S/C19H21N3O4S/c1-19(2)25-16-15(23-10-11-7-5-4-6-8-11)14(24-18(16)26-19)13-12(9-20)17(27-3)22-21-13/h4-8,14-16,18H,10H2,1-3H3,(H,21,22)/t14-,15+,16+,18+/m1/s1 |
| InChIKey | LRTNCROSHSHCFE-CVYDXHPNSA-N |
| XLogP | 3.14 |
| TPSA | 89.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.46 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |