C20H26F3N3O4 — CID 102255780
ethyl 2-diazo-3-(4-methoxy-N-(2,2,2-trifluoroacetyl)anilino)nonanoate (PubChem CID 102255780) has the molecular formula C20H26F3N3O4 and a molecular weight of 429.44 g/mol. Its IUPAC name is ethyl 2-diazo-3-(4-methoxy-N-(2,2,2-trifluoroacetyl)anilino)nonanoate.
| Compound Name | ethyl 2-diazo-3-(4-methoxy-N-(2,2,2-trifluoroacetyl)anilino)nonanoate |
|---|---|
| PubChem CID | 102255780 |
| Molecular Formula | C20H26F3N3O4 |
| Molecular Weight | 429.44 g/mol |
| Exact Mass | 429.19 |
| IUPAC Name | ethyl 2-diazo-3-(4-methoxy-N-(2,2,2-trifluoroacetyl)anilino)nonanoate |
| SMILES | CCCCCCC(C(=[N+]=[N-])C(=O)OCC)N(C(=O)C(F)(F)F)c1ccc(OC)cc1 |
| InChI | InChI=1S/C20H26F3N3O4/c1-4-6-7-8-9-16(17(25-24)18(27)30-5-2)26(19(28)20(21,22)23)14-10-12-15(29-3)13-11-14/h10-13,16H,4-9H2,1-3H3 |
| InChIKey | SKUNQBWKPFGOJY-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 92.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.44 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|