C25H31ClO5 — CID 10225637
(2R)-7-[3-[2-chloro-4-(2-methylpropyl)phenoxy]propoxy]-2-ethyl-3,4-dihydrochromene-2-carboxylic acid (PubChem CID 10225637) has the molecular formula C25H31ClO5 and a molecular weight of 446.97 g/mol. Its IUPAC name is (2R)-7-[3-[2-chloro-4-(2-methylpropyl)phenoxy]propoxy]-2-ethyl-3,4-dihydrochromene-2-carboxylic acid.
| Compound Name | (2R)-7-[3-[2-chloro-4-(2-methylpropyl)phenoxy]propoxy]-2-ethyl-3,4-dihydrochromene-2-carboxylic acid |
|---|---|
| PubChem CID | 10225637 |
| Molecular Formula | C25H31ClO5 |
| Molecular Weight | 446.97 g/mol |
| Exact Mass | 446.19 |
| IUPAC Name | (2R)-7-[3-[2-chloro-4-(2-methylpropyl)phenoxy]propoxy]-2-ethyl-3,4-dihydrochromene-2-carboxylic acid |
| SMILES | CC[C@]1(C(=O)O)CCc2ccc(OCCCOc3ccc(CC(C)C)cc3Cl)cc2O1 |
| InChI | InChI=1S/C25H31ClO5/c1-4-25(24(27)28)11-10-19-7-8-20(16-23(19)31-25)29-12-5-13-30-22-9-6-18(14-17(2)3)15-21(22)26/h6-9,15-17H,4-5,10-14H2,1-3H3,(H,27,28)/t25-/m1/s1 |
| InChIKey | FGGPKBRONOYGCT-RUZDIDTESA-N |
| XLogP | 5.94 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.97 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|