C17H24N2O3Si — CID 102257176
3-ethyl-1-(4-methoxyphenyl)-6-methyl-5-trimethylsilylpyrimidine-2,4-dione (PubChem CID 102257176) has the molecular formula C17H24N2O3Si and a molecular weight of 332.48 g/mol. Its IUPAC name is 3-ethyl-1-(4-methoxyphenyl)-6-methyl-5-trimethylsilylpyrimidine-2,4-dione.
| Compound Name | 3-ethyl-1-(4-methoxyphenyl)-6-methyl-5-trimethylsilylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 102257176 |
| Molecular Formula | C17H24N2O3Si |
| Molecular Weight | 332.48 g/mol |
| Exact Mass | 332.16 |
| IUPAC Name | 3-ethyl-1-(4-methoxyphenyl)-6-methyl-5-trimethylsilylpyrimidine-2,4-dione |
| SMILES | CCn1c(=O)c([Si](C)(C)C)c(C)n(-c2ccc(OC)cc2)c1=O |
| InChI | InChI=1S/C17H24N2O3Si/c1-7-18-16(20)15(23(4,5)6)12(2)19(17(18)21)13-8-10-14(22-3)11-9-13/h8-11H,7H2,1-6H3 |
| InChIKey | JLKBHOWBNLMIAK-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 53.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.48 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|