C10H12F3NO3S — CID 102260980
1,1,1-trifluoro-N-[3-(4-hydroxyphenyl)propyl]methanesulfonamide (PubChem CID 102260980) has the molecular formula C10H12F3NO3S and a molecular weight of 283.27 g/mol. Its IUPAC name is 1,1,1-trifluoro-N-[3-(4-hydroxyphenyl)propyl]methanesulfonamide.
| Compound Name | 1,1,1-trifluoro-N-[3-(4-hydroxyphenyl)propyl]methanesulfonamide |
|---|---|
| PubChem CID | 102260980 |
| Molecular Formula | C10H12F3NO3S |
| Molecular Weight | 283.27 g/mol |
| Exact Mass | 283.05 |
| IUPAC Name | 1,1,1-trifluoro-N-[3-(4-hydroxyphenyl)propyl]methanesulfonamide |
| SMILES | O=S(=O)(NCCCc1ccc(O)cc1)C(F)(F)F |
| InChI | InChI=1S/C10H12F3NO3S/c11-10(12,13)18(16,17)14-7-1-2-8-3-5-9(15)6-4-8/h3-6,14-15H,1-2,7H2 |
| InChIKey | VMOTWQJRDLLWBD-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.27 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|