C20H40O4Si — CID 102261254
(8S)-8-[tert-butyl(dimethyl)silyl]oxy-1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]nonan-4-one (PubChem CID 102261254) has the molecular formula C20H40O4Si and a molecular weight of 372.62 g/mol. Its IUPAC name is (8S)-8-[tert-butyl(dimethyl)silyl]oxy-1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]nonan-4-one.
| Compound Name | (8S)-8-[tert-butyl(dimethyl)silyl]oxy-1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]nonan-4-one |
|---|---|
| PubChem CID | 102261254 |
| Molecular Formula | C20H40O4Si |
| Molecular Weight | 372.62 g/mol |
| Exact Mass | 372.27 |
| IUPAC Name | (8S)-8-[tert-butyl(dimethyl)silyl]oxy-1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]nonan-4-one |
| SMILES | C[C@@H](CCCC(=O)CCC[C@@H]1COC(C)(C)O1)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C20H40O4Si/c1-16(24-25(7,8)19(2,3)4)11-9-12-17(21)13-10-14-18-15-22-20(5,6)23-18/h16,18H,9-15H2,1-8H3/t16-,18+/m0/s1 |
| InChIKey | QQHUAHNDZZNBOY-FUHWJXTLSA-N |
| XLogP | 5.46 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.62 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|