C18H30N2O6 — CID 102265606
2,6-bis[(3-ethyloxetane-3-carbonyl)amino]hexanoic acid (PubChem CID 102265606) has the molecular formula C18H30N2O6 and a molecular weight of 370.45 g/mol. Its IUPAC name is 2,6-bis[(3-ethyloxetane-3-carbonyl)amino]hexanoic acid.
| Compound Name | 2,6-bis[(3-ethyloxetane-3-carbonyl)amino]hexanoic acid |
|---|---|
| PubChem CID | 102265606 |
| Molecular Formula | C18H30N2O6 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.21 |
| IUPAC Name | 2,6-bis[(3-ethyloxetane-3-carbonyl)amino]hexanoic acid |
| SMILES | CCC1(C(=O)NCCCCC(NC(=O)C2(CC)COC2)C(=O)O)COC1 |
| InChI | InChI=1S/C18H30N2O6/c1-3-17(9-25-10-17)15(23)19-8-6-5-7-13(14(21)22)20-16(24)18(4-2)11-26-12-18/h13H,3-12H2,1-2H3,(H,19,23)(H,20,24)(H,21,22) |
| InChIKey | VHFFVAQKJDKVRI-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 113.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|