C11H9F3N2O4 — CID 102270129
[C-(4-nitrophenyl)-N-(2,2,2-trifluoroethyl)carbonimidoyl] acetate (PubChem CID 102270129) has the molecular formula C11H9F3N2O4 and a molecular weight of 290.20 g/mol. Its IUPAC name is [C-(4-nitrophenyl)-N-(2,2,2-trifluoroethyl)carbonimidoyl] acetate.
| Compound Name | [C-(4-nitrophenyl)-N-(2,2,2-trifluoroethyl)carbonimidoyl] acetate |
|---|---|
| PubChem CID | 102270129 |
| Molecular Formula | C11H9F3N2O4 |
| Molecular Weight | 290.20 g/mol |
| Exact Mass | 290.05 |
| IUPAC Name | [C-(4-nitrophenyl)-N-(2,2,2-trifluoroethyl)carbonimidoyl] acetate |
| SMILES | CC(=O)O/C(=N\CC(F)(F)F)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C11H9F3N2O4/c1-7(17)20-10(15-6-11(12,13)14)8-2-4-9(5-3-8)16(18)19/h2-5H,6H2,1H3/b15-10- |
| InChIKey | VVRSLNVBKIMUFA-GDNBJRDFSA-N |
| XLogP | 2.47 |
| TPSA | 81.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.20 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|