C15H17NO5 — CID 102276976
benzyl (3S)-3-methoxycarbonyloxy-3,6-dihydro-2H-pyridine-1-carboxylate (PubChem CID 102276976) has the molecular formula C15H17NO5 and a molecular weight of 291.30 g/mol. Its IUPAC name is benzyl (3S)-3-methoxycarbonyloxy-3,6-dihydro-2H-pyridine-1-carboxylate.
| Compound Name | benzyl (3S)-3-methoxycarbonyloxy-3,6-dihydro-2H-pyridine-1-carboxylate |
|---|---|
| PubChem CID | 102276976 |
| Molecular Formula | C15H17NO5 |
| Molecular Weight | 291.30 g/mol |
| Exact Mass | 291.11 |
| IUPAC Name | benzyl (3S)-3-methoxycarbonyloxy-3,6-dihydro-2H-pyridine-1-carboxylate |
| SMILES | COC(=O)O[C@H]1C=CCN(C(=O)OCc2ccccc2)C1 |
| InChI | InChI=1S/C15H17NO5/c1-19-15(18)21-13-8-5-9-16(10-13)14(17)20-11-12-6-3-2-4-7-12/h2-8,13H,9-11H2,1H3/t13-/m0/s1 |
| InChIKey | ZUNADPVLJRVFIC-ZDUSSCGKSA-N |
| XLogP | 2.35 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.30 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|