C13H24O3Si — CID 102278843
hydroxy-dimethyl-[(1E,3E)-3-methyl-5-(oxan-2-yloxy)penta-1,3-dienyl]silane (PubChem CID 102278843) has the molecular formula C13H24O3Si and a molecular weight of 256.42 g/mol. Its IUPAC name is hydroxy-dimethyl-[(1E,3E)-3-methyl-5-(oxan-2-yloxy)penta-1,3-dienyl]silane.
| Compound Name | hydroxy-dimethyl-[(1E,3E)-3-methyl-5-(oxan-2-yloxy)penta-1,3-dienyl]silane |
|---|---|
| PubChem CID | 102278843 |
| Molecular Formula | C13H24O3Si |
| Molecular Weight | 256.42 g/mol |
| Exact Mass | 256.15 |
| IUPAC Name | hydroxy-dimethyl-[(1E,3E)-3-methyl-5-(oxan-2-yloxy)penta-1,3-dienyl]silane |
| SMILES | CC(/C=C/[Si](C)(C)O)=C\COC1CCCCO1 |
| InChI | InChI=1S/C13H24O3Si/c1-12(8-11-17(2,3)14)7-10-16-13-6-4-5-9-15-13/h7-8,11,13-14H,4-6,9-10H2,1-3H3/b11-8+,12-7+ |
| InChIKey | HOMZVMDREXKHGQ-NFLJZBCPSA-N |
| XLogP | 2.77 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.42 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|