C17H20O5 — CID 102279042
dimethyl 2-(3-cyclopentylidene-4-oxocyclopenten-1-yl)cyclopropane-1,1-dicarboxylate (PubChem CID 102279042) has the molecular formula C17H20O5 and a molecular weight of 304.34 g/mol. Its IUPAC name is dimethyl 2-(3-cyclopentylidene-4-oxocyclopenten-1-yl)cyclopropane-1,1-dicarboxylate.
| Compound Name | dimethyl 2-(3-cyclopentylidene-4-oxocyclopenten-1-yl)cyclopropane-1,1-dicarboxylate |
|---|---|
| PubChem CID | 102279042 |
| Molecular Formula | C17H20O5 |
| Molecular Weight | 304.34 g/mol |
| Exact Mass | 304.13 |
| IUPAC Name | dimethyl 2-(3-cyclopentylidene-4-oxocyclopenten-1-yl)cyclopropane-1,1-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)CC1C1=CC(=C2CCCC2)C(=O)C1 |
| InChI | InChI=1S/C17H20O5/c1-21-15(19)17(16(20)22-2)9-13(17)11-7-12(14(18)8-11)10-5-3-4-6-10/h7,13H,3-6,8-9H2,1-2H3 |
| InChIKey | QKNVJRXASQJZTA-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.34 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|