C16H18N2 — CID 102279443
4-[2-(3H-inden-1-yl)ethyl]-3,5-dimethyl-1H-pyrazole (PubChem CID 102279443) has the molecular formula C16H18N2 and a molecular weight of 238.33 g/mol. Its IUPAC name is 4-[2-(3H-inden-1-yl)ethyl]-3,5-dimethyl-1H-pyrazole.
| Compound Name | 4-[2-(3H-inden-1-yl)ethyl]-3,5-dimethyl-1H-pyrazole |
|---|---|
| PubChem CID | 102279443 |
| Molecular Formula | C16H18N2 |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.15 |
| IUPAC Name | 4-[2-(3H-inden-1-yl)ethyl]-3,5-dimethyl-1H-pyrazole |
| SMILES | Cc1n[nH]c(C)c1CCC1=CCc2ccccc21 |
| InChI | InChI=1S/C16H18N2/c1-11-15(12(2)18-17-11)10-9-14-8-7-13-5-3-4-6-16(13)14/h3-6,8H,7,9-10H2,1-2H3,(H,17,18) |
| InChIKey | MIDHNYBKNPFQTD-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |