C15H17NNa2O6S2 — CID 102280054
disodium;2-[naphthalen-1-ylmethyl(2-sulfonatoethyl)amino]ethanesulfonate (PubChem CID 102280054) has the molecular formula C15H17NNa2O6S2 and a molecular weight of 417.42 g/mol. Its IUPAC name is disodium;2-[naphthalen-1-ylmethyl(2-sulfonatoethyl)amino]ethanesulfonate.
| Compound Name | disodium;2-[naphthalen-1-ylmethyl(2-sulfonatoethyl)amino]ethanesulfonate |
|---|---|
| PubChem CID | 102280054 |
| Molecular Formula | C15H17NNa2O6S2 |
| Molecular Weight | 417.42 g/mol |
| Exact Mass | 417.03 |
| IUPAC Name | disodium;2-[naphthalen-1-ylmethyl(2-sulfonatoethyl)amino]ethanesulfonate |
| SMILES | O=S(=O)([O-])CCN(CCS(=O)(=O)[O-])Cc1cccc2ccccc12.[Na+].[Na+] |
| InChI | InChI=1S/C15H19NO6S2.2Na/c17-23(18,19)10-8-16(9-11-24(20,21)22)12-14-6-3-5-13-4-1-2-7-15(13)14;;/h1-7H,8-12H2,(H,17,18,19)(H,20,21,22);;/q;2*+1/p-2 |
| InChIKey | PZVGDMKHZWEIJJ-UHFFFAOYSA-L |
| XLogP | -5.26 |
| TPSA | 117.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.42 |
| LogP ≤ 5 | -5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|