C15H19NO6S2 — CID 102280055
2-[naphthalen-1-ylmethyl(2-sulfoethyl)amino]ethanesulfonic acid (PubChem CID 102280055) has the molecular formula C15H19NO6S2 and a molecular weight of 373.45 g/mol. Its IUPAC name is 2-[naphthalen-1-ylmethyl(2-sulfoethyl)amino]ethanesulfonic acid.
| Compound Name | 2-[naphthalen-1-ylmethyl(2-sulfoethyl)amino]ethanesulfonic acid |
|---|---|
| PubChem CID | 102280055 |
| Molecular Formula | C15H19NO6S2 |
| Molecular Weight | 373.45 g/mol |
| Exact Mass | 373.07 |
| IUPAC Name | 2-[naphthalen-1-ylmethyl(2-sulfoethyl)amino]ethanesulfonic acid |
| SMILES | O=S(=O)(O)CCN(CCS(=O)(=O)O)Cc1cccc2ccccc12 |
| InChI | InChI=1S/C15H19NO6S2/c17-23(18,19)10-8-16(9-11-24(20,21)22)12-14-6-3-5-13-4-1-2-7-15(13)14/h1-7H,8-12H2,(H,17,18,19)(H,20,21,22) |
| InChIKey | UACAXNOUYGMJIM-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 111.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.45 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|