C12H11F3O — CID 102282204
[(E)-3-(3,3,3-trifluoroprop-1-en-2-yloxy)prop-1-enyl]benzene (PubChem CID 102282204) has the molecular formula C12H11F3O and a molecular weight of 228.21 g/mol. Its IUPAC name is [(E)-3-(3,3,3-trifluoroprop-1-en-2-yloxy)prop-1-enyl]benzene.
| Compound Name | [(E)-3-(3,3,3-trifluoroprop-1-en-2-yloxy)prop-1-enyl]benzene |
|---|---|
| PubChem CID | 102282204 |
| Molecular Formula | C12H11F3O |
| Molecular Weight | 228.21 g/mol |
| Exact Mass | 228.08 |
| IUPAC Name | [(E)-3-(3,3,3-trifluoroprop-1-en-2-yloxy)prop-1-enyl]benzene |
| SMILES | C=C(OC/C=C/c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C12H11F3O/c1-10(12(13,14)15)16-9-5-8-11-6-3-2-4-7-11/h2-8H,1,9H2/b8-5+ |
| InChIKey | KJXWSNAMUUKELA-VMPITWQZSA-N |
| XLogP | 3.79 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.21 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|