C36H35N2O+ — CID 102282688
4-[(R)-[(1R,2R,4S,5R)-1-anthracen-9-yl-5-ethenyl-1-azoniabicyclo[2.2.2]octan-2-yl]-prop-2-enoxymethyl]quinoline (PubChem CID 102282688) has the molecular formula C36H35N2O+ and a molecular weight of 511.69 g/mol. Its IUPAC name is 4-[(R)-[(1R,2R,4S,5R)-1-anthracen-9-yl-5-ethenyl-1-azoniabicyclo[2.2.2]octan-2-yl]-prop-2-enoxymethyl]quinoline.
| Compound Name | 4-[(R)-[(1R,2R,4S,5R)-1-anthracen-9-yl-5-ethenyl-1-azoniabicyclo[2.2.2]octan-2-yl]-prop-2-enoxymethyl]quinoline |
|---|---|
| PubChem CID | 102282688 |
| Molecular Formula | C36H35N2O+ |
| Molecular Weight | 511.69 g/mol |
| Exact Mass | 511.27 |
| IUPAC Name | 4-[(R)-[(1R,2R,4S,5R)-1-anthracen-9-yl-5-ethenyl-1-azoniabicyclo[2.2.2]octan-2-yl]-prop-2-enoxymethyl]quinoline |
| SMILES | C=CCO[C@H](c1ccnc2ccccc12)[C@H]1C[C@@H]2CC[N@@+]1(c1c3ccccc3cc3ccccc13)C[C@@H]2C=C |
| InChI | InChI=1S/C36H35N2O/c1-3-21-39-36(32-17-19-37-33-16-10-9-15-31(32)33)34-23-26-18-20-38(34,24-25(26)4-2)35-29-13-7-5-11-27(29)22-28-12-6-8-14-30(28)35/h3-17,19,22,25-26,34,36H,1-2,18,20-21,23-24H2/q+1/t25-,26-,34+,36+,38+/m0/s1 |
| InChIKey | VSUBKUJXLSNBKT-HHOUOREBSA-N |
| XLogP | 8.39 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.69 |
| LogP ≤ 5 | 8.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|