C23H14F6N4OS2 — CID 102283428
13,13,14,14,15,15-hexafluoro-6,7-dimethyl-4-(1-oxidopyridin-1-ium-2-yl)-9-pyridin-2-yl-5,8-dithia-3,10-diazatetracyclo[10.3.0.02,6.07,11]pentadeca-1,3,9,11-tetraene (PubChem CID 102283428) has the molecular formula C23H14F6N4OS2 and a molecular weight of 540.51 g/mol. Its IUPAC name is 13,13,14,14,15,15-hexafluoro-6,7-dimethyl-4-(1-oxidopyridin-1-ium-2-yl)-9-pyridin-2-yl-5,8-dithia-3,10-diazatetracyclo[10.3.0.02,6.07,11]pentadeca-1,3,9,11-tetraene.
| Compound Name | 13,13,14,14,15,15-hexafluoro-6,7-dimethyl-4-(1-oxidopyridin-1-ium-2-yl)-9-pyridin-2-yl-5,8-dithia-3,10-diazatetracyclo[10.3.0.02,6.07,11]pentadeca-1,3,9,11-tetraene |
|---|---|
| PubChem CID | 102283428 |
| Molecular Formula | C23H14F6N4OS2 |
| Molecular Weight | 540.51 g/mol |
| Exact Mass | 540.05 |
| IUPAC Name | 13,13,14,14,15,15-hexafluoro-6,7-dimethyl-4-(1-oxidopyridin-1-ium-2-yl)-9-pyridin-2-yl-5,8-dithia-3,10-diazatetracyclo[10.3.0.02,6.07,11]pentadeca-1,3,9,11-tetraene |
| SMILES | CC12SC(c3ccccn3)=NC1=C1C(=C3N=C(c4cccc[n+]4[O-])SC32C)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C23H14F6N4OS2/c1-19-15(31-17(35-19)11-7-3-5-9-30-11)13-14(22(26,27)23(28,29)21(13,24)25)16-20(19,2)36-18(32-16)12-8-4-6-10-33(12)34/h3-10H,1-2H3 |
| InChIKey | HCDREPZCKDSULH-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 64.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.51 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|