C27H22Cl2F6N2S2 — CID 71662874
4-[8,8,9,9,10,10-hexafluoro-1,2-dimethyl-14-(1-methylpyridin-1-ium-4-yl)-3,15-dithiatetracyclo[10.3.0.02,6.07,11]pentadeca-4,6,11,13-tetraen-4-yl]-1-methylpyridin-1-ium dichloride (PubChem CID 71662874) has the molecular formula C27H22Cl2F6N2S2 and a molecular weight of 623.52 g/mol. Its IUPAC name is 4-[8,8,9,9,10,10-hexafluoro-1,2-dimethyl-14-(1-methylpyridin-1-ium-4-yl)-3,15-dithiatetracyclo[10.3.0.02,6.07,11]pentadeca-4,6,11,13-tetraen-4-yl]-1-methylpyridin-1-ium dichloride.
| Compound Name | 4-[8,8,9,9,10,10-hexafluoro-1,2-dimethyl-14-(1-methylpyridin-1-ium-4-yl)-3,15-dithiatetracyclo[10.3.0.02,6.07,11]pentadeca-4,6,11,13-tetraen-4-yl]-1-methylpyridin-1-ium dichloride |
|---|---|
| PubChem CID | 71662874 |
| Molecular Formula | C27H22Cl2F6N2S2 |
| Molecular Weight | 623.52 g/mol |
| Exact Mass | 622.05 |
| IUPAC Name | 4-[8,8,9,9,10,10-hexafluoro-1,2-dimethyl-14-(1-methylpyridin-1-ium-4-yl)-3,15-dithiatetracyclo[10.3.0.02,6.07,11]pentadeca-4,6,11,13-tetraen-4-yl]-1-methylpyridin-1-ium dichloride |
| SMILES | C[n+]1ccc(C2=CC3=C4C(=C5C=C(c6cc[n+](C)cc6)SC5(C)C3(C)S2)C(F)(F)C(F)(F)C4(F)F)cc1.[Cl-].[Cl-] |
| InChI | InChI=1S/C27H22F6N2S2.2ClH/c1-23-17(13-19(36-23)15-5-9-34(3)10-6-15)21-22(26(30,31)27(32,33)25(21,28)29)18-14-20(37-24(18,23)2)16-7-11-35(4)12-8-16;;/h5-14H,1-4H3;2*1H/q+2;;/p-2 |
| InChIKey | OGAHSWUPVZLLTL-UHFFFAOYSA-L |
| XLogP | 0.26 |
| TPSA | 7.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.52 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|