C16H28F2O6Si — CID 102286209
ethyl 2-[(1S,2S,4R,5R,6S)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-hydroxy-3,7-dioxabicyclo[4.1.0]heptan-2-yl]-2,2-difluoroacetate (PubChem CID 102286209) has the molecular formula C16H28F2O6Si and a molecular weight of 382.48 g/mol. Its IUPAC name is ethyl 2-[(1S,2S,4R,5R,6S)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-hydroxy-3,7-dioxabicyclo[4.1.0]heptan-2-yl]-2,2-difluoroacetate.
| Compound Name | ethyl 2-[(1S,2S,4R,5R,6S)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-hydroxy-3,7-dioxabicyclo[4.1.0]heptan-2-yl]-2,2-difluoroacetate |
|---|---|
| PubChem CID | 102286209 |
| Molecular Formula | C16H28F2O6Si |
| Molecular Weight | 382.48 g/mol |
| Exact Mass | 382.16 |
| IUPAC Name | ethyl 2-[(1S,2S,4R,5R,6S)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-hydroxy-3,7-dioxabicyclo[4.1.0]heptan-2-yl]-2,2-difluoroacetate |
| SMILES | CCOC(=O)C(F)(F)[C@H]1O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H]2O[C@@H]21 |
| InChI | InChI=1S/C16H28F2O6Si/c1-7-21-14(20)16(17,18)13-12-11(24-12)10(19)9(23-13)8-22-25(5,6)15(2,3)4/h9-13,19H,7-8H2,1-6H3/t9-,10-,11+,12+,13+/m1/s1 |
| InChIKey | ITLOBXAPMCDRJY-BNDIWNMDSA-N |
| XLogP | 2.10 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.48 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|