C10H14F2O6 — CID 102286207
ethyl 2,2-difluoro-2-[(4R,5R)-5-hydroxy-4-(hydroxymethyl)-3,7-dioxabicyclo[4.1.0]heptan-2-yl]acetate (PubChem CID 102286207) has the molecular formula C10H14F2O6 and a molecular weight of 268.21 g/mol. Its IUPAC name is ethyl 2,2-difluoro-2-[(4R,5R)-5-hydroxy-4-(hydroxymethyl)-3,7-dioxabicyclo[4.1.0]heptan-2-yl]acetate.
| Compound Name | ethyl 2,2-difluoro-2-[(4R,5R)-5-hydroxy-4-(hydroxymethyl)-3,7-dioxabicyclo[4.1.0]heptan-2-yl]acetate |
|---|---|
| PubChem CID | 102286207 |
| Molecular Formula | C10H14F2O6 |
| Molecular Weight | 268.21 g/mol |
| Exact Mass | 268.08 |
| IUPAC Name | ethyl 2,2-difluoro-2-[(4R,5R)-5-hydroxy-4-(hydroxymethyl)-3,7-dioxabicyclo[4.1.0]heptan-2-yl]acetate |
| SMILES | CCOC(=O)C(F)(F)C1O[C@H](CO)[C@@H](O)C2OC21 |
| InChI | InChI=1S/C10H14F2O6/c1-2-16-9(15)10(11,12)8-7-6(18-7)5(14)4(3-13)17-8/h4-8,13-14H,2-3H2,1H3/t4-,5-,6?,7?,8?/m1/s1 |
| InChIKey | VLJKMMVPBZOYIS-LRGMQIARSA-N |
| XLogP | -0.93 |
| TPSA | 88.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.21 |
| LogP ≤ 5 | -0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|