C19H36O5Si — CID 102286151
12-[tert-butyl(dimethyl)silyl]oxy-2-hydroxy-5,15-dioxabicyclo[12.1.0]pentadecan-4-one (PubChem CID 102286151) has the molecular formula C19H36O5Si and a molecular weight of 372.58 g/mol. Its IUPAC name is 12-[tert-butyl(dimethyl)silyl]oxy-2-hydroxy-5,15-dioxabicyclo[12.1.0]pentadecan-4-one.
| Compound Name | 12-[tert-butyl(dimethyl)silyl]oxy-2-hydroxy-5,15-dioxabicyclo[12.1.0]pentadecan-4-one |
|---|---|
| PubChem CID | 102286151 |
| Molecular Formula | C19H36O5Si |
| Molecular Weight | 372.58 g/mol |
| Exact Mass | 372.23 |
| IUPAC Name | 12-[tert-butyl(dimethyl)silyl]oxy-2-hydroxy-5,15-dioxabicyclo[12.1.0]pentadecan-4-one |
| SMILES | CC(C)(C)[Si](C)(C)OC1CCCCCCOC(=O)CC(O)C2OC2C1 |
| InChI | InChI=1S/C19H36O5Si/c1-19(2,3)25(4,5)24-14-10-8-6-7-9-11-22-17(21)13-15(20)18-16(12-14)23-18/h14-16,18,20H,6-13H2,1-5H3 |
| InChIKey | ZVNXLPCAMYOATG-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.58 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|