C15H28O5Si — CID 101439185
ethyl 2-[(1R,4S,5R,6R)-5-[tert-butyl(dimethyl)silyl]oxy-3,7-dioxabicyclo[4.1.0]heptan-4-yl]acetate (PubChem CID 101439185) has the molecular formula C15H28O5Si and a molecular weight of 316.47 g/mol. Its IUPAC name is ethyl 2-[(1R,4S,5R,6R)-5-[tert-butyl(dimethyl)silyl]oxy-3,7-dioxabicyclo[4.1.0]heptan-4-yl]acetate.
| Compound Name | ethyl 2-[(1R,4S,5R,6R)-5-[tert-butyl(dimethyl)silyl]oxy-3,7-dioxabicyclo[4.1.0]heptan-4-yl]acetate |
|---|---|
| PubChem CID | 101439185 |
| Molecular Formula | C15H28O5Si |
| Molecular Weight | 316.47 g/mol |
| Exact Mass | 316.17 |
| IUPAC Name | ethyl 2-[(1R,4S,5R,6R)-5-[tert-butyl(dimethyl)silyl]oxy-3,7-dioxabicyclo[4.1.0]heptan-4-yl]acetate |
| SMILES | CCOC(=O)C[C@@H]1OC[C@H]2O[C@H]2[C@@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C15H28O5Si/c1-7-17-12(16)8-10-14(13-11(19-13)9-18-10)20-21(5,6)15(2,3)4/h10-11,13-14H,7-9H2,1-6H3/t10-,11+,13+,14+/m0/s1 |
| InChIKey | AIRKQPQIHJHPNX-OIMNJJJWSA-N |
| XLogP | 2.50 |
| TPSA | 57.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.47 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|